ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| Nome del prodotto |
3-Fluoro-4-methylbenzonitrile |
| Sinonimi |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| Formula molecolare |
C8H6FN |
| Peso Molecolare |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| Numero CAS |
170572-49-3 |
| Struttura molecolare |
|
| Densità |
1.117g/cm3 |
| Punto di fusione |
48-50℃ |
| Punto di ebollizione |
215.069°C at 760 mmHg |
| Indice di rifrazione |
1.508 |
| Punto d'infiammabilità |
90.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
