ChemNet > CAS > 1706-11-2 2,5-Dimethylanisole
1706-11-2 2,5-Dimethylanisole
| Nome del prodotto |
2,5-Dimethylanisole |
| Sinonimi |
1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
| Formula molecolare |
C9H12O |
| Peso Molecolare |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| Numero CAS |
1706-11-2 |
| EINECS |
216-943-8 |
| Struttura molecolare |
|
| Densità |
0.932g/cm3 |
| Punto di ebollizione |
189.7°C at 760 mmHg |
| Indice di rifrazione |
1.495 |
| Punto d'infiammabilità |
66.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
