ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| Nome del prodotto |
2,3-Dichlorothiophene |
| Sinonimi |
2,3-dichloro-thiophene |
| Formula molecolare |
C4H2Cl2S |
| Peso Molecolare |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| Numero CAS |
17249-79-5;17249-29-5 |
| Struttura molecolare |
|
| Densità |
1.488g/cm3 |
| Punto di fusione |
-26℃ |
| Punto di ebollizione |
170.7°C at 760 mmHg |
| Indice di rifrazione |
1.584 |
| Punto d'infiammabilità |
68.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
