ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
| Nome del prodotto |
6-methoxypyridine-3-carbothioamide |
| Sinonimi |
6-methoxy-3-Pyridinecarbothioamide |
| Formula molecolare |
C7H8N2OS |
| Peso Molecolare |
168.2162 |
| InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
| Numero CAS |
175277-49-3 |
| Struttura molecolare |
|
| Densità |
1.262g/cm3 |
| Punto di fusione |
150℃ |
| Punto di ebollizione |
292.5°C at 760 mmHg |
| Indice di rifrazione |
1.626 |
| Punto d'infiammabilità |
130.7°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
