ChemNet > CAS > 175278-27-0 2,4-dichloro-6-methylbenzamide
175278-27-0 2,4-dichloro-6-methylbenzamide
| Nome del prodotto |
2,4-dichloro-6-methylbenzamide |
| Formula molecolare |
C8H7Cl2NO |
| Peso Molecolare |
204.0533 |
| InChI |
InChI=1/C8H7Cl2NO/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3H,1H3,(H2,11,12) |
| Numero CAS |
175278-27-0 |
| Struttura molecolare |
|
| Densità |
1.375g/cm3 |
| Punto di fusione |
151℃ |
| Punto di ebollizione |
265.1°C at 760 mmHg |
| Indice di rifrazione |
1.586 |
| Punto d'infiammabilità |
114.1°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
