ChemNet > CAS > 175278-28-1 5-Fluoro-2-methylbenzamide
175278-28-1 5-Fluoro-2-methylbenzamide
| Nome del prodotto |
5-Fluoro-2-methylbenzamide |
| Formula molecolare |
C8H8FNO |
| Peso Molecolare |
153.1536 |
| InChI |
InChI=1/C8H8FNO/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H2,10,11) |
| Numero CAS |
175278-28-1 |
| Struttura molecolare |
|
| Densità |
1.19g/cm3 |
| Punto di fusione |
120℃ |
| Punto di ebollizione |
214.6°C at 760 mmHg |
| Indice di rifrazione |
1.534 |
| Punto d'infiammabilità |
83.6°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
