ChemNet > CAS > 1766-76-3 decafluorobenzhydrol
1766-76-3 decafluorobenzhydrol
| Nome del prodotto |
decafluorobenzhydrol |
| Sinonimi |
Bis(pentafluorophenyl) carbinol; Bis(pentafluorophenyl)methanol; bis(pentafluorophenyl)methanol |
| Formula molecolare |
C13H2F10O |
| Peso Molecolare |
364.1384 |
| InChI |
InChI=1/C13H2F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17/h13,24H |
| Numero CAS |
1766-76-3 |
| EINECS |
217-185-0 |
| Struttura molecolare |
|
| Densità |
1.74g/cm3 |
| Punto di fusione |
76-80℃ |
| Punto di ebollizione |
265.2°C at 760 mmHg |
| Indice di rifrazione |
1.457 |
| Punto d'infiammabilità |
114.2°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
