ChemNet > CAS > 17846-15-0 adamantane-1-carbohydrazide
17846-15-0 adamantane-1-carbohydrazide
| Nome del prodotto |
adamantane-1-carbohydrazide |
| Sinonimi |
tricyclo[3.3.1.1~3,7~]decane-1-carbohydrazide |
| Formula molecolare |
C11H18N2O |
| Peso Molecolare |
194.2734 |
| InChI |
InChI=1/C11H18N2O/c12-13-10(14)11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6,12H2,(H,13,14) |
| Numero CAS |
17846-15-0 |
| Struttura molecolare |
|
| Densità |
1.203g/cm3 |
| Punto di fusione |
157℃ |
| Punto di ebollizione |
370.8°C at 760 mmHg |
| Indice di rifrazione |
1.581 |
| Punto d'infiammabilità |
178°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
