ChemNet > CAS > 1817-47-6 4-Isopropylnitrobenzene
1817-47-6 4-Isopropylnitrobenzene
| Nome del prodotto |
4-Isopropylnitrobenzene |
| Sinonimi |
4-Isopropylnitrobenzene~4-Nitrocumene; 1-(1-methylethyl)-4-nitro-benzene; 4-Nitrocumene; 1-Isopropyl-4-Nitrobenzene; 4-Nitro-Isopropylbenzene; 1-nitro-4-(propan-2-yl)benzene |
| Formula molecolare |
C9H11NO2 |
| Peso Molecolare |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
| Numero CAS |
1817-47-6 |
| EINECS |
217-326-6 |
| Struttura molecolare |
|
| Densità |
1.091g/cm3 |
| Punto di ebollizione |
236.4°C at 760 mmHg |
| Indice di rifrazione |
1.533 |
| Punto d'infiammabilità |
99.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
