ChemNet > CAS > 192702-01-5 3-Chloro-4-fluorobenzyl bromide
192702-01-5 3-Chloro-4-fluorobenzyl bromide
| Nome del prodotto |
3-Chloro-4-fluorobenzyl bromide |
| Sinonimi |
alpha-Bromo-3-chloro-4-fluorotoluene; 4-(bromomethyl)-2-chloro-1-fluorobenzene |
| Formula molecolare |
C7H5BrClF |
| Peso Molecolare |
223.47 |
| InChI |
InChI=1/C7H5BrClF/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
| Numero CAS |
192702-01-5 |
| Struttura molecolare |
|
| Densità |
1.654g/cm3 |
| Punto di ebollizione |
235°C at 760 mmHg |
| Indice di rifrazione |
1.561 |
| Punto d'infiammabilità |
95.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
