ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
| Nome del prodotto |
2-Bromo-4-fluoro-1-iodobenzene |
| Sinonimi |
2-Bromo-4-fluoroiodobenzene |
| Formula molecolare |
C6H3BrFI |
| Peso Molecolare |
300.8949 |
| InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| Numero CAS |
202865-73-4 |
| Struttura molecolare |
|
| Densità |
2.281g/cm3 |
| Punto di ebollizione |
243.2°C at 760 mmHg |
| Indice di rifrazione |
1.628 |
| Punto d'infiammabilità |
100.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
