ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
| Nome del prodotto |
3-Chloro-4-fluoroanisole |
| Sinonimi |
2-chloro-1-fluoro-4-methoxybenzene |
| Formula molecolare |
C7H6ClFO |
| Peso Molecolare |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| Numero CAS |
202925-07-3 |
| Struttura molecolare |
|
| Densità |
1.239g/cm3 |
| Punto di ebollizione |
202.8°C at 760 mmHg |
| Indice di rifrazione |
1.495 |
| Punto d'infiammabilità |
76.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
