ChemNet > CAS > 208173-22-2 2,3,6-trifluoroacetophenone
208173-22-2 2,3,6-trifluoroacetophenone
| Nome del prodotto |
2,3,6-trifluoroacetophenone |
| Sinonimi |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
| Formula molecolare |
C8H5F3O |
| Peso Molecolare |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| Numero CAS |
208173-22-2 |
| Struttura molecolare |
|
| Densità |
1.303g/cm3 |
| Punto di ebollizione |
187.2°C at 760 mmHg |
| Indice di rifrazione |
1.455 |
| Punto d'infiammabilità |
65°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
