ChemNet > CAS > 208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
| Nome del prodotto |
5-Chloro-1,2-dibromo-3-fluorobenzene |
| Sinonimi |
5-Chloro-2,3-dibromo-1-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene |
| Formula molecolare |
C6H2Br2ClF |
| Peso Molecolare |
288.3395 |
| InChI |
InChI=1/C6H2Br2ClF/c7-4-1-3(9)2-5(10)6(4)8/h1-2H |
| Numero CAS |
208186-78-1 |
| Struttura molecolare |
|
| Densità |
2.089g/cm3 |
| Punto di ebollizione |
245.3°C at 760 mmHg |
| Indice di rifrazione |
1.589 |
| Punto d'infiammabilità |
102.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
