ChemNet > CAS > 212779-19-6 2,3,5-Trichlorobenzeneboronic acid
212779-19-6 2,3,5-Trichlorobenzeneboronic acid
| Nome del prodotto |
2,3,5-Trichlorobenzeneboronic acid |
| Sinonimi |
Thiocarbamoylhydrazine; (2,3,5-trichlorophenyl)boronic acid; Boronic acid,B-(2,3,5-trichlorophenyl)-; 2,3,5-Trichlorophenylboronic acid |
| Formula molecolare |
C6H4BCl3O2 |
| Peso Molecolare |
225.2648 |
| InChI |
InChI=1/C6H4BCl3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H |
| Numero CAS |
212779-19-6 |
| Struttura molecolare |
|
| Densità |
1.6g/cm3 |
| Punto di ebollizione |
383.4°C at 760 mmHg |
| Indice di rifrazione |
1.594 |
| Punto d'infiammabilità |
185.7°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
