ChemNet > CAS > 215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
| Nome del prodotto |
1-(2-chloro-6-fluorobenzyl)piperazine |
| Formula molecolare |
C11H14ClFN2 |
| Peso Molecolare |
228.6937 |
| InChI |
InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2 |
| Numero CAS |
215655-20-2 |
| Struttura molecolare |
|
| Densità |
1.216g/cm3 |
| Punto di ebollizione |
299.7°C at 760 mmHg |
| Indice di rifrazione |
1.544 |
| Punto d'infiammabilità |
135°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
