ChemNet > CAS > 22225-77-0 2-(difluoromethoxy)nitrobenzene
22225-77-0 2-(difluoromethoxy)nitrobenzene
| Nome del prodotto |
2-(difluoromethoxy)nitrobenzene |
| Sinonimi |
1-(Difluoromethoxy)-2-nitrobenzene |
| Formula molecolare |
C7H5F2NO3 |
| Peso Molecolare |
189.1163 |
| InChI |
InChI=1/C7H5F2NO3/c8-7(9)13-6-4-2-1-3-5(6)10(11)12/h1-4,7H |
| Numero CAS |
22225-77-0 |
| Struttura molecolare |
|
| Densità |
1.384g/cm3 |
| Punto di ebollizione |
249.4°C at 760 mmHg |
| Indice di rifrazione |
1.494 |
| Punto d'infiammabilità |
104.6°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
