ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| Nome del prodotto |
2-(difluoromethoxy)aniline |
| Sinonimi |
2-Difluoromethoxyaniline |
| Formula molecolare |
C7H7F2NO |
| Peso Molecolare |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| Numero CAS |
22236-04-0 |
| Struttura molecolare |
|
| Densità |
1.253g/cm3 |
| Punto di ebollizione |
209.8°C at 760 mmHg |
| Indice di rifrazione |
1.501 |
| Punto d'infiammabilità |
80.7°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
