ChemNet > CAS > 22237-12-3 (3-Amino-4-methylphenyl)boronic acid, hydrochloride
22237-12-3 (3-Amino-4-methylphenyl)boronic acid, hydrochloride
| Nome del prodotto |
(3-Amino-4-methylphenyl)boronic acid, hydrochloride |
| Sinonimi |
3-Amino-4-methylphenylboronic acid~3-Amino-p-tolylboronic acid; 3-Amino-4-methylbenzeneboronic acid; 5-(dihydroxyboranyl)-2-methylanilinium chloride; (3-amino-4-methylphenyl)boronic acid; 3-Amino-4-Methylphenylboronic Acid Hydrochloride |
| Formula molecolare |
C7H10BNO2 |
| Peso Molecolare |
150.9708 |
| InChI |
InChI=1/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3 |
| Numero CAS |
22237-12-3 |
| Struttura molecolare |
|
| Densità |
1.19g/cm3 |
| Punto di ebollizione |
367.6°C at 760 mmHg |
| Indice di rifrazione |
1.569 |
| Punto d'infiammabilità |
176.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
