ChemNet > CAS > 22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
| Nome del prodotto |
benzoic acid, compound with dicyclohexylamine (1:1) |
| Sinonimi |
Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1); Benzoic acid dicyclohexylamine salt; Dicyclohexylamine benzoate; Dicyclohexylammonium benzoate; Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI); Benzoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine, compd. with benzoic acid (7CI); N-cyclohexylcyclohexanamine benzoate (1:1) |
| Formula molecolare |
C19H29NO2 |
| Peso Molecolare |
303.4391 |
| InChI |
InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| Numero CAS |
22355-34-6 |
| EINECS |
244-932-8 |
| Struttura molecolare |
|
| Punto di ebollizione |
256.1°C at 760 mmHg |
| Punto d'infiammabilità |
96.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
|
|
