ChemNet > CAS > 22567-21-1 (+)-dihydrocarveol, mixture of isomers
22567-21-1 (+)-dihydrocarveol, mixture of isomers
| Nome del prodotto |
(+)-dihydrocarveol, mixture of isomers |
| Sinonimi |
(+)-Dihydrocarveol; 2-methyl-5-(prop-1-en-2-yl)cyclohexanol; (1S,2S,5S)-2-methyl-5-(prop-1-en-2-yl)cyclohexanol |
| Formula molecolare |
C10H18O |
| Peso Molecolare |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-11H,1,4-6H2,2-3H3/t8-,9-,10-/m0/s1 |
| Numero CAS |
22567-21-1 |
| EINECS |
245-085-7 |
| Struttura molecolare |
|
| Densità |
0.912g/cm3 |
| Punto di ebollizione |
225°C at 760 mmHg |
| Indice di rifrazione |
1.472 |
| Punto d'infiammabilità |
91.7°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
|
|
