ChemNet > CAS > 23141-61-9 6-Methyl-5-nitroquinoline
23141-61-9 6-Methyl-5-nitroquinoline
| Nome del prodotto |
6-Methyl-5-nitroquinoline |
| Sinonimi |
NSC 162892; 6-methyl-5-nitro-isoquinoline |
| Formula molecolare |
C10H8N2O2 |
| Peso Molecolare |
188.18 |
| InChI |
InChI=1/C10H8N2O2/c1-7-2-3-8-6-11-5-4-9(8)10(7)12(13)14/h2-6H,1H3 |
| Numero CAS |
23141-61-9 |
| EINECS |
245-447-4 |
| Struttura molecolare |
|
| Densità |
1.298g/cm3 |
| Punto di fusione |
117℃ |
| Punto di ebollizione |
342.4°C at 760 mmHg |
| Indice di rifrazione |
1.661 |
| Punto d'infiammabilità |
160.9°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
