ChemNet > CAS > 2350-89-2 4-Vinylbiphenyl
2350-89-2 4-Vinylbiphenyl
| Nome del prodotto |
4-Vinylbiphenyl |
| Sinonimi |
4-Phenylstyrene; 4-ethenylbiphenyl |
| Formula molecolare |
C14H12 |
| Peso Molecolare |
180.2451 |
| InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
| Numero CAS |
2350-89-2 |
| EINECS |
219-082-6 |
| Struttura molecolare |
|
| Densità |
0.997g/cm3 |
| Punto di fusione |
115-121℃ |
| Punto di ebollizione |
301.7°C at 760 mmHg |
| Indice di rifrazione |
1.599 |
| Punto d'infiammabilità |
139.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
