ChemNet > CAS > 2396-85-2 methyl trans-2-octenoate
2396-85-2 methyl trans-2-octenoate
| Nome del prodotto |
methyl trans-2-octenoate |
| Sinonimi |
219-259-8; Methyl oct-2-enoate; methyl (2E)-oct-2-enoate |
| Formula molecolare |
C9H16O2 |
| Peso Molecolare |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-4-5-6-7-8-9(10)11-2/h7-8H,3-6H2,1-2H3/b8-7+ |
| Numero CAS |
2396-85-2 |
| EINECS |
219-259-8 |
| Struttura molecolare |
|
| Densità |
0.896g/cm3 |
| Punto di ebollizione |
194.6°C at 760 mmHg |
| Indice di rifrazione |
1.436 |
| Punto d'infiammabilità |
82.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
