ChemNet > CAS > 3138-86-1 2,3-Bis(bromomethyl)quinoxaline
3138-86-1 2,3-Bis(bromomethyl)quinoxaline
| Nome del prodotto |
2,3-Bis(bromomethyl)quinoxaline |
| Sinonimi |
2,3-Bis-(bromethyl)-quinoxaline 98% |
| Formula molecolare |
C10H8Br2N2 |
| Peso Molecolare |
315.9919 |
| InChI |
InChI=1/C10H8Br2N2/c11-5-9-10(6-12)14-8-4-2-1-3-7(8)13-9/h1-4H,5-6H2 |
| Numero CAS |
3138-86-1 |
| EINECS |
221-538-4 |
| Struttura molecolare |
|
| Densità |
1.869g/cm3 |
| Punto di fusione |
150-154℃ |
| Punto di ebollizione |
345.7°C at 760 mmHg |
| Indice di rifrazione |
1.703 |
| Punto d'infiammabilità |
162.9°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
