ChemNet > CAS > 3156-39-6 beta,2-Dinitrostyrene
3156-39-6 beta,2-Dinitrostyrene
| Nome del prodotto |
beta,2-Dinitrostyrene |
| Sinonimi |
2-Nitro-1-(2-nitrophenyl)ethene~2-Nitro-beta-nitrostyrene; 1-nitro-2-[(E)-2-nitroethenyl]benzene |
| Formula molecolare |
C8H6N2O4 |
| Peso Molecolare |
194.1442 |
| InChI |
InChI=1/C8H6N2O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H/b6-5+ |
| Numero CAS |
3156-39-6 |
| Struttura molecolare |
|
| Densità |
1.401g/cm3 |
| Punto di ebollizione |
356.6°C at 760 mmHg |
| Indice di rifrazione |
1.642 |
| Punto d'infiammabilità |
183.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
