ChemNet > CAS > 32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
| Nome del prodotto |
2-Chloro-6-fluoro-3-methylbenzoic acid |
| Sinonimi |
2-Chloro-6-fluoro-m-toluic acid |
| Formula molecolare |
C8H6ClFO2 |
| Peso Molecolare |
188.5834 |
| InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
| Numero CAS |
32890-89-4 |
| Struttura molecolare |
|
| Densità |
1.403g/cm3 |
| Punto di ebollizione |
278.1°C at 760 mmHg |
| Indice di rifrazione |
1.551 |
| Punto d'infiammabilità |
122°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
