ChemNet > CAS > 3316-09-4 4-Nitrocatechol
3316-09-4 4-Nitrocatechol
| Nome del prodotto |
4-Nitrocatechol |
| Sinonimi |
4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
| Formula molecolare |
C6H5NO4 |
| Peso Molecolare |
155.1082 |
| InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
| Numero CAS |
3316-09-4 |
| EINECS |
222-009-0 |
| Struttura molecolare |
|
| Densità |
1.58g/cm3 |
| Punto di fusione |
173-177℃ |
| Punto di ebollizione |
358.2°C at 760 mmHg |
| Indice di rifrazione |
1.667 |
| Punto d'infiammabilità |
168.8°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
