ChemNet > CAS > 33901-46-1 4-Nitrophenoxyacetonitrile
33901-46-1 4-Nitrophenoxyacetonitrile
| Nome del prodotto |
4-Nitrophenoxyacetonitrile |
| Formula molecolare |
C8H6N2O3 |
| Peso Molecolare |
178.1448 |
| InChI |
InChI=1/C8H6N2O3/c9-5-6-13-8-3-1-7(2-4-8)10(11)12/h1-4H,6H2 |
| Numero CAS |
33901-46-1 |
| Struttura molecolare |
|
| Densità |
1.317g/cm3 |
| Punto di fusione |
74-76℃ |
| Punto di ebollizione |
363.9°C at 760 mmHg |
| Indice di rifrazione |
1.564 |
| Punto d'infiammabilità |
173.9°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
