ChemNet > CAS > 33974-27-5 phenyl(4-pyridyl)methanol
33974-27-5 phenyl(4-pyridyl)methanol
| Nome del prodotto |
phenyl(4-pyridyl)methanol |
| Sinonimi |
alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
| Formula molecolare |
C12H11NO |
| Peso Molecolare |
185.2218 |
| InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
| Numero CAS |
33974-27-5 |
| EINECS |
251-770-1 |
| Struttura molecolare |
|
| Densità |
1.155g/cm3 |
| Punto di fusione |
120℃ |
| Punto di ebollizione |
353.5°C at 760 mmHg |
| Indice di rifrazione |
1.604 |
| Punto d'infiammabilità |
167.6°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
