ChemNet > CAS > 38939-88-7 3-Chloro-4-nitrotoluene
38939-88-7 3-Chloro-4-nitrotoluene
| Nome del prodotto |
3-Chloro-4-nitrotoluene |
| Sinonimi |
2-chloro-4-methyl-1-nitrobenzene |
| Formula molecolare |
C7H6ClNO2 |
| Peso Molecolare |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
| Numero CAS |
38939-88-7 |
| EINECS |
254-199-6 |
| Struttura molecolare |
|
| Densità |
1.324g/cm3 |
| Punto di fusione |
22-27℃ |
| Punto di ebollizione |
273.4°C at 760 mmHg |
| Indice di rifrazione |
1.57 |
| Punto d'infiammabilità |
119.1°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
