ChemNet > CAS > 39101-54-7 3,5-Dimethylphenylacetonitrile
39101-54-7 3,5-Dimethylphenylacetonitrile
| Nome del prodotto |
3,5-Dimethylphenylacetonitrile |
| Sinonimi |
3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
| Formula molecolare |
C10H11N |
| Peso Molecolare |
145.201 |
| InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
| Numero CAS |
39101-54-7 |
| EINECS |
254-292-1 |
| Struttura molecolare |
|
| Densità |
0.979g/cm3 |
| Punto di ebollizione |
254.5°C at 760 mmHg |
| Indice di rifrazione |
1.524 |
| Punto d'infiammabilità |
117.5°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
