ChemNet > CAS > 41186-03-2 1-(3-Methylphenyl)-piperazine
41186-03-2 1-(3-Methylphenyl)-piperazine
| Nome del prodotto |
1-(3-Methylphenyl)-piperazine |
| Sinonimi |
N-(m-Tolyl)piperazine; 1-(3-Methylphenyl)piperazine; 1-m-tolylpiperazine |
| Formula molecolare |
C11H16N2 |
| Peso Molecolare |
176.2581 |
| InChI |
InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3 |
| Numero CAS |
41186-03-2 |
| EINECS |
255-251-0 |
| Struttura molecolare |
|
| Densità |
1.012g/cm3 |
| Punto di ebollizione |
321.4°C at 760 mmHg |
| Indice di rifrazione |
1.54 |
| Punto d'infiammabilità |
154°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
