ChemNet > CAS > 4146-43-4 Succinic dihydrazide
4146-43-4 Succinic dihydrazide
| Nome del prodotto |
Succinic dihydrazide |
| Sinonimi |
Butanedioyl dihydrazide; Succinic acid dihydrazide; butanedihydrazide |
| Formula molecolare |
C4H10N4O2 |
| Peso Molecolare |
146.1478 |
| InChI |
InChI=1/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
| Numero CAS |
4146-43-4 |
| EINECS |
223-970-9 |
| Struttura molecolare |
|
| Densità |
1.284g/cm3 |
| Punto di fusione |
170-168℃ |
| Punto di ebollizione |
540.2°C at 760 mmHg |
| Indice di rifrazione |
1.525 |
| Punto d'infiammabilità |
280.5°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
