ChemNet > CAS > 4160-51-4 4'-methoxybutyrophenone
4160-51-4 4'-methoxybutyrophenone
| Nome del prodotto |
4'-methoxybutyrophenone |
| Sinonimi |
1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
| Formula molecolare |
C11H14O2 |
| Peso Molecolare |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| Numero CAS |
4160-51-4 |
| EINECS |
223-995-5 |
| Struttura molecolare |
|
| Densità |
1.001g/cm3 |
| Punto di ebollizione |
288.3°C at 760 mmHg |
| Indice di rifrazione |
1.498 |
| Punto d'infiammabilità |
124.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
