ChemNet > CAS > 4160-63-8 2-(4-Methoxybenzoyl)thiophene
4160-63-8 2-(4-Methoxybenzoyl)thiophene
| Nome del prodotto |
2-(4-Methoxybenzoyl)thiophene |
| Sinonimi |
p-anisyl thiophen-2-yl ketone; (4-methoxyphenyl)(thiophen-2-yl)methanone; (4-methylphenyl)(thiophen-2-yl)methanone |
| Formula molecolare |
C12H10OS |
| Peso Molecolare |
202.2722 |
| InChI |
InChI=1/C12H10OS/c1-9-4-6-10(7-5-9)12(13)11-3-2-8-14-11/h2-8H,1H3 |
| Numero CAS |
4160-63-8 |
| EINECS |
223-997-6 |
| Struttura molecolare |
|
| Densità |
1.167g/cm3 |
| Punto di fusione |
73-76℃ |
| Punto di ebollizione |
340.6°C at 760 mmHg |
| Indice di rifrazione |
1.599 |
| Punto d'infiammabilità |
159.8°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
