ChemNet > CAS > 4286-15-1 S(+)-2-phenylbutyric acid
4286-15-1 S(+)-2-phenylbutyric acid
| Nome del prodotto |
S(+)-2-phenylbutyric acid |
| Sinonimi |
(S)-(+)-2-Phenylbutyric acid; (S)-(+)-alpha-Ethylphenylacetic acid; (2S)-2-phenylbutanoic acid |
| Formula molecolare |
C10H12O2 |
| Peso Molecolare |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12)/t9-/m0/s1 |
| Numero CAS |
4286-15-1 |
| EINECS |
201-982-5 |
| Struttura molecolare |
|
| Densità |
1.09g/cm3 |
| Punto di ebollizione |
272.9°C at 760 mmHg |
| Indice di rifrazione |
1.531 |
| Punto d'infiammabilità |
170.2°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
