ChemNet > CAS > 43111-32-6 3-Chlorophenoxyacetonitrile
43111-32-6 3-Chlorophenoxyacetonitrile
| Nome del prodotto |
3-Chlorophenoxyacetonitrile |
| Formula molecolare |
C8H6ClNO |
| Peso Molecolare |
167.5923 |
| InChI |
InChI=1/C8H6ClNO/c9-7-2-1-3-8(6-7)11-5-4-10/h1-3,6H,5H2 |
| Numero CAS |
43111-32-6 |
| Struttura molecolare |
|
| Densità |
1.238g/cm3 |
| Punto di fusione |
30℃ |
| Punto di ebollizione |
279.8°C at 760 mmHg |
| Indice di rifrazione |
1.538 |
| Punto d'infiammabilità |
123°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
