ChemNet > CAS > 446-09-3 2-Bromo-5-fluoronitrobenzene
446-09-3 2-Bromo-5-fluoronitrobenzene
| Nome del prodotto |
2-Bromo-5-fluoronitrobenzene |
| Sinonimi |
1-Bromo-4-fluoro-2-nitrobenzene |
| Formula molecolare |
C6H3BrFNO2 |
| Peso Molecolare |
219.9959 |
| InChI |
InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| Numero CAS |
446-09-3 |
| EINECS |
207-160-2 |
| Struttura molecolare |
|
| Densità |
1.808g/cm3 |
| Punto di fusione |
37-39℃ |
| Punto di ebollizione |
220.9°C at 760 mmHg |
| Indice di rifrazione |
1.579 |
| Punto d'infiammabilità |
87.4°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
