ChemNet > CAS > 4463-33-6 2,3-Dimethoxytoluene
4463-33-6 2,3-Dimethoxytoluene
| Nome del prodotto |
2,3-Dimethoxytoluene |
| Sinonimi |
3-Methylveratrole; 1,2-dimethoxy-3-methylbenzene |
| Formula molecolare |
C9H12O2 |
| Peso Molecolare |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
| Numero CAS |
4463-33-6 |
| EINECS |
224-726-4 |
| Struttura molecolare |
|
| Densità |
0.99g/cm3 |
| Punto di ebollizione |
201.4°C at 760 mmHg |
| Indice di rifrazione |
1.489 |
| Punto d'infiammabilità |
67.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
