ChemNet > CAS > 4900-63-4 1-Methoxy-4-nitronaphthalene
4900-63-4 1-Methoxy-4-nitronaphthalene
| Nome del prodotto |
1-Methoxy-4-nitronaphthalene |
| Sinonimi |
methyl 4-nitronaphthyl ether |
| Formula molecolare |
C11H9NO3 |
| Peso Molecolare |
203.1941 |
| InChI |
InChI=1/C11H9NO3/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3 |
| Numero CAS |
4900-63-4 |
| EINECS |
225-528-0 |
| Struttura molecolare |
|
| Densità |
1.274g/cm3 |
| Punto di fusione |
83-85℃ |
| Punto di ebollizione |
367.2°C at 760 mmHg |
| Indice di rifrazione |
1.638 |
| Punto d'infiammabilità |
178.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
