ChemNet > CAS > 4906-24-5 3-Acetoxy-2-butanone
4906-24-5 3-Acetoxy-2-butanone
| Nome del prodotto |
3-Acetoxy-2-butanone |
| Sinonimi |
Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
| Formula molecolare |
C6H10O3 |
| Peso Molecolare |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| Numero CAS |
4906-24-5 |
| Struttura molecolare |
|
| Densità |
1.012g/cm3 |
| Punto di ebollizione |
163.4°C at 760 mmHg |
| Indice di rifrazione |
1.406 |
| Punto d'infiammabilità |
56.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
