ChemNet > CAS > 499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
499771-07-2 1-benzyl-4-(3-nitropyridin-2-yl)piperazine
| Nome del prodotto |
1-benzyl-4-(3-nitropyridin-2-yl)piperazine |
| Formula molecolare |
C16H18N4O2 |
| Peso Molecolare |
298.3397 |
| InChI |
InChI=1/C16H18N4O2/c21-20(22)15-7-4-8-17-16(15)19-11-9-18(10-12-19)13-14-5-2-1-3-6-14/h1-8H,9-13H2 |
| Numero CAS |
499771-07-2 |
| Struttura molecolare |
|
| Densità |
1.263g/cm3 |
| Punto di fusione |
64℃ |
| Punto di ebollizione |
453°C at 760 mmHg |
| Indice di rifrazione |
1.628 |
| Punto d'infiammabilità |
227.7°C |
| Simboli di pericolo |
 C:Corrosive;
|
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
