ChemNet > CAS > 50262-67-4 p-Nonyloxyaniline
50262-67-4 p-Nonyloxyaniline
| Nome del prodotto |
p-Nonyloxyaniline |
| Sinonimi |
4-n-Nonyloxyaniline; 4-(nonyloxy)aniline |
| Formula molecolare |
C15H25NO |
| Peso Molecolare |
235.3651 |
| InChI |
InChI=1/C15H25NO/c1-2-3-4-5-6-7-8-13-17-15-11-9-14(16)10-12-15/h9-12H,2-8,13,16H2,1H3 |
| Numero CAS |
50262-67-4 |
| Struttura molecolare |
|
| Densità |
0.949g/cm3 |
| Punto di ebollizione |
356.5°C at 760 mmHg |
| Indice di rifrazione |
1.511 |
| Punto d'infiammabilità |
159.3°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
