ChemNet > CAS > 51632-28-1 4-Ethylphenylacetonitrile
51632-28-1 4-Ethylphenylacetonitrile
| Nome del prodotto |
4-Ethylphenylacetonitrile |
| Sinonimi |
4-Ethylbenzyl cyanide |
| Formula molecolare |
C10H11N |
| Peso Molecolare |
145.201 |
| InChI |
InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
| Numero CAS |
51632-28-1 |
| Struttura molecolare |
|
| Densità |
0.978g/cm3 |
| Punto di ebollizione |
252.8°C at 760 mmHg |
| Indice di rifrazione |
1.521 |
| Punto d'infiammabilità |
116.1°C |
| Simboli di pericolo |
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|
