ChemNet > CAS > 51788-80-8 4-Fluoro-2-methoxyacetophenone
51788-80-8 4-Fluoro-2-methoxyacetophenone
| Nome del prodotto |
4-Fluoro-2-methoxyacetophenone |
| Sinonimi |
2'-methoxy-4'-fluoroacetophenone; 4'-Fluoro-2'-methoxyacetophenone |
| Formula molecolare |
C9H9FO2 |
| Peso Molecolare |
168.16 |
| InChI |
InChI=1/C9H9FO2/c1-6(11)8-4-3-7(10)5-9(8)12-2/h3-5H,1-2H3 |
| Numero CAS |
51788-80-8 |
| Struttura molecolare |
|
| Simboli di pericolo |
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
