ChemNet > CAS > 527-61-7 2,6-Dimethylbenzoquinone
527-61-7 2,6-Dimethylbenzoquinone
| Nome del prodotto |
2,6-Dimethylbenzoquinone |
| Formula molecolare |
C8H8O2 |
| Peso Molecolare |
136.15 |
| InChI |
InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| Numero CAS |
527-61-7 |
| EINECS |
208-420-8 |
| Struttura molecolare |
|
| Punto di fusione |
69-74℃ |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
