ChemNet > CAS > 585-99-9 D-(+)-MELIBIOSE
585-99-9 D-(+)-MELIBIOSE
| Nome del prodotto |
D-(+)-MELIBIOSE |
| Formula molecolare |
C12H22O11 |
| Peso Molecolare |
342.2965 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5+,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
| Numero CAS |
585-99-9 |
| EINECS |
209-568-6 |
| Struttura molecolare |
|
| Densità |
1.76g/cm3 |
| Punto di fusione |
182℃ |
| Punto di ebollizione |
662.8°C at 760 mmHg |
| Indice di rifrazione |
1.652 |
| Punto d'infiammabilità |
354.6°C |
| Simboli di pericolo |
|
| Codici di Rischio |
|
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|
