ChemNet > CAS > 589-55-9 4-Heptanol
589-55-9 4-Heptanol
| Nome del prodotto |
4-Heptanol |
| Sinonimi |
Dipropylcarbinol; heptan-4-ol |
| Formula molecolare |
C7H16O |
| Peso Molecolare |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| Numero CAS |
589-55-9 |
| EINECS |
209-651-7 |
| Struttura molecolare |
|
| Densità |
0.818g/cm3 |
| Punto di ebollizione |
161.3°C at 760 mmHg |
| Indice di rifrazione |
1.42 |
| Punto d'infiammabilità |
61.8°C |
| Simboli di pericolo |
 Xi:Irritant;
|
| Codici di Rischio |
R10:Flammable.;
R36:Irritating to eyes.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|
