ChemNet > CAS > 59918-68-2 3-furancarbothioamide
59918-68-2 3-furancarbothioamide
| Nome del prodotto |
3-furancarbothioamide |
| Sinonimi |
furan-3-carbothioamide |
| Formula molecolare |
C5H5NOS |
| Peso Molecolare |
127.1643 |
| InChI |
InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| Numero CAS |
59918-68-2 |
| Struttura molecolare |
|
| Densità |
1.287g/cm3 |
| Punto di fusione |
74℃ |
| Punto di ebollizione |
219.6°C at 760 mmHg |
| Indice di rifrazione |
1.62 |
| Punto d'infiammabilità |
86.6°C |
| Simboli di pericolo |
 Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
